상품명칭 |
Tris[2-(diphenylphosphino)ethyl]phosphine |
별명 |
Tris(2-diphenylphosphinoethyl)phosphine; TETRAPHOS-II; (phosphanetriyltriethane-2,1-diyl)tris(diphenylphosphane) |
분자식 |
C42H42P4 |
분자량 |
670.6779 |
InChI |
InChI=1/C42H42P4/c1-7-19-37(20-8-1)44(38-21-9-2-10-22-38)34-31-43(32-35-45(39-23-11-3-12-24-39)40-25-13-4-14-26-40)33-36-46(41-27-15-5-16-28-41)42-29-17-6-18-30-42/h1-30H,31-36H2 |
cas번호 |
23582-03-8 |
EC번호 |
245-754-3 |
분자 구조 |
|
녹는 점 |
134-135℃ |
비등점 |
740.1°C at 760 mmHg |
인화점 |
429.4°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|